C50H88O15 — CID 162220075
2-[2-(1-ethylcyclohexyl)oxy-2-oxoethoxy]ethyl 2,2-dimethylbutanoate;bis(2-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]ethyl 2-methylbutanoate) (PubChem CID 162220075) has the molecular formula C50H88O15 and a molecular weight of 929.24 g/mol. Its IUPAC name is 2-[2-(1-ethylcyclohexyl)oxy-2-oxoethoxy]ethyl 2,2-dimethylbutanoate;bis(2-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]ethyl 2-methylbutanoate).
| Compound Name | 2-[2-(1-ethylcyclohexyl)oxy-2-oxoethoxy]ethyl 2,2-dimethylbutanoate;bis(2-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]ethyl 2-methylbutanoate) |
|---|---|
| PubChem CID | 162220075 |
| Molecular Formula | C50H88O15 |
| Molecular Weight | 929.24 g/mol |
| Exact Mass | 928.61 |
| IUPAC Name | 2-[2-(1-ethylcyclohexyl)oxy-2-oxoethoxy]ethyl 2,2-dimethylbutanoate;bis(2-[2-(1-methylcyclohexyl)oxy-2-oxoethoxy]ethyl 2-methylbutanoate) |
| SMILES | CCC(C)C(=O)OCCOCC(=O)OC1(C)CCCCC1.CCC(C)C(=O)OCCOCC(=O)OC1(C)CCCCC1.CCC1(OC(=O)COCCOC(=O)C(C)(C)CC)CCCCC1 |
| InChI | InChI=1S/C18H32O5.2C16H28O5/c1-5-17(3,4)16(20)22-13-12-21-14-15(19)23-18(6-2)10-8-7-9-11-18;2*1-4-13(2)15(18)20-11-10-19-12-14(17)21-16(3)8-6-5-7-9-16/h5-14H2,1-4H3;2*13H,4-12H2,1-3H3 |
| InChIKey | ZTZPPDXZHPGDRP-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.24 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|