C14H12Cl2N4O11S2 — CID 162221049
6-chloro-2-hydroxy-3-nitrobenzenesulfonamide;(3-chloro-6-nitro-2-sulfamoylphenyl) acetate (PubChem CID 162221049) has the molecular formula C14H12Cl2N4O11S2 and a molecular weight of 547.31 g/mol. Its IUPAC name is 6-chloro-2-hydroxy-3-nitrobenzenesulfonamide;(3-chloro-6-nitro-2-sulfamoylphenyl) acetate.
| Compound Name | 6-chloro-2-hydroxy-3-nitrobenzenesulfonamide;(3-chloro-6-nitro-2-sulfamoylphenyl) acetate |
|---|---|
| PubChem CID | 162221049 |
| Molecular Formula | C14H12Cl2N4O11S2 |
| Molecular Weight | 547.31 g/mol |
| Exact Mass | 545.93 |
| IUPAC Name | 6-chloro-2-hydroxy-3-nitrobenzenesulfonamide;(3-chloro-6-nitro-2-sulfamoylphenyl) acetate |
| SMILES | CC(=O)Oc1c([N+](=O)[O-])ccc(Cl)c1S(N)(=O)=O.NS(=O)(=O)c1c(Cl)ccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C8H7ClN2O6S.C6H5ClN2O5S/c1-4(12)17-7-6(11(13)14)3-2-5(9)8(7)18(10,15)16;7-3-1-2-4(9(11)12)5(10)6(3)15(8,13)14/h2-3H,1H3,(H2,10,15,16);1-2,10H,(H2,8,13,14) |
| InChIKey | ZUCVRDKNAJEVGA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 253.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|