About CID 162222280
CID 162222280 (PubChem CID 162222280) has the molecular formula C54H84B3O6
and a molecular weight of 861.70 g/mol.
Molecular Properties
| Compound Name | CID 162222280 |
| PubChem CID | 162222280 |
| Molecular Formula | C54H84B3O6 |
| Molecular Weight | 861.70 g/mol |
| Exact Mass | 861.65 |
| IUPAC Name | — |
| SMILES | CC.CC.CC.CC.CC.CC.CCc1ccc(C2CC(=O)CC(=O)C2)cc1.CCc1cccc(C2CC(=O)CC(=O)C2)c1.CCc1ccccc1C1CC(=O)CC(=O)C1.[B].[B].[B] |
| InChI | InChI=1S/3C14H16O2.6C2H6.3B/c1-2-10-3-5-11(6-4-10)12-7-13(15)9-14(16)8-12;1-2-10-4-3-5-11(6-10)12-7-13(15)9-14(16)8-12;1-2-10-5-3-4-6-14(10)11-7-12(15)9-13(16)8-11;6*1-2;;;/h2*3-6,12H,2,7-9H2,1H3;3-6,11H,2,7-9H2,1H3;6*1-2H3;;; |
| InChIKey | FXSOXNLETPHFBZ-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 861.70 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162222280 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162222280?
The IUPAC name of CID 162222280 (CID 162222280) is not available.
What is the SMILES notation for CID 162222280?
The canonical SMILES for CID 162222280 is CC.CC.CC.CC.CC.CC.CCc1ccc(C2CC(=O)CC(=O)C2)cc1.CCc1cccc(C2CC(=O)CC(=O)C2)c1.CCc1ccccc1C1CC(=O)CC(=O)C1.[B].[B].[B].
What is the InChIKey of CID 162222280?
The InChIKey is FXSOXNLETPHFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C14H16O2.6C2H6.3B/c1-2-10-3-5-11(6-4-10)12-7-13(15)9-14(16)8-12;1-2-10-4-3-5-11(6-10)12-7-13(15)9-14(16)8-12;1-2-10-5-3-4-6-14(10)11-7-12(15)9-13(16)8-11;6*1-2;;;/h2*3-6,12H,2,7-9H2,1H3;3-6,11H,2,7-9H2,1H3;6*1-2H3;;;.
What are the key properties of CID 162222280?
CID 162222280 has a molecular weight of 861.70 g/mol, XLogP of 12.98, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162222280 is sourced from PubChem (CID 162222280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).