C35H38BF4N3O2 — CID 162223333
2,4-bis(4-tert-butylphenyl)-6-[2,3,5,6-tetrafluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine (PubChem CID 162223333) has the molecular formula C35H38BF4N3O2 and a molecular weight of 619.51 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[2,3,5,6-tetrafluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[2,3,5,6-tetrafluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 162223333 |
| Molecular Formula | C35H38BF4N3O2 |
| Molecular Weight | 619.51 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[2,3,5,6-tetrafluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3c(F)c(F)c(B4OC(C)(C)C(C)(C)O4)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C35H38BF4N3O2/c1-32(2,3)21-15-11-19(12-16-21)29-41-30(20-13-17-22(18-14-20)33(4,5)6)43-31(42-29)23-25(37)27(39)24(28(40)26(23)38)36-44-34(7,8)35(9,10)45-36/h11-18H,1-10H3 |
| InChIKey | ZUKRVQFKGYAEED-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.51 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|