C21H22F2N4O2S2 — CID 162225847
(3S)-3-[3-fluoro-5-[2-fluoro-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine (PubChem CID 162225847) has the molecular formula C21H22F2N4O2S2 and a molecular weight of 464.56 g/mol. Its IUPAC name is (3S)-3-[3-fluoro-5-[2-fluoro-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3S)-3-[3-fluoro-5-[2-fluoro-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 162225847 |
| Molecular Formula | C21H22F2N4O2S2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | (3S)-3-[3-fluoro-5-[2-fluoro-5-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3cc(-c4nnc(C)o4)ccc3F)cc2F)N=C(N)C1(C)C |
| InChI | InChI=1S/C21H22F2N4O2S2/c1-11-26-27-18(29-11)12-6-7-14(22)13(8-12)16-9-15(23)17(30-16)21(4)10-31(5,28)20(2,3)19(24)25-21/h6-9H,5,10H2,1-4H3,(H2,24,25)/t21-,31?/m0/s1 |
| InChIKey | KMPXQAXCXUANDA-FEAGIOCNSA-N |
| XLogP | 4.13 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|