C20H30O7 — CID 162225863
2-[(1R,3S,6R)-3-hydroxy-6-methylcycloheptyl]-4-methoxy-4-oxobutanoic acid;8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 162225863) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is 2-[(1R,3S,6R)-3-hydroxy-6-methylcycloheptyl]-4-methoxy-4-oxobutanoic acid;8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 2-[(1R,3S,6R)-3-hydroxy-6-methylcycloheptyl]-4-methoxy-4-oxobutanoic acid;8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 162225863 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[(1R,3S,6R)-3-hydroxy-6-methylcycloheptyl]-4-methoxy-4-oxobutanoic acid;8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | COC(=O)CC(C(=O)O)[C@@H]1C[C@H](C)CC[C@H](O)C1.O=C1CC2C=CC(C1)O2 |
| InChI | InChI=1S/C13H22O5.C7H8O2/c1-8-3-4-10(14)6-9(5-8)11(13(16)17)7-12(15)18-2;8-5-3-6-1-2-7(4-5)9-6/h8-11,14H,3-7H2,1-2H3,(H,16,17);1-2,6-7H,3-4H2/t8-,9-,10+,11?;/m1./s1 |
| InChIKey | ZUTFJXNLVQRSMZ-ALBZQVRFSA-N |
| XLogP | 2.11 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|