C40H60B2N4O2 — CID 162227805
CID 162227805 (PubChem CID 162227805) has the molecular formula C40H60B2N4O2 and a molecular weight of 650.57 g/mol.
| Compound Name | CID 162227805 |
|---|---|
| PubChem CID | 162227805 |
| Molecular Formula | C40H60B2N4O2 |
| Molecular Weight | 650.57 g/mol |
| Exact Mass | 650.49 |
| IUPAC Name | — |
| SMILES | [B]=NCCCC(C)(CCCN=[B])c1cc(C)c(O)c(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(C(C)(CCCC)CCCC)cc(C)c2O)c1 |
| InChI | InChI=1S/C40H60B2N4O2/c1-7-9-17-39(5,18-10-8-2)33-23-29(3)37(47)31(25-33)27-43-35-15-11-12-16-36(35)44-28-32-26-34(24-30(4)38(32)48)40(6,19-13-21-45-41)20-14-22-46-42/h23-28,35-36,47-48H,7-22H2,1-6H3/b43-27+,44-28+/t35-,36-/m1/s1 |
| InChIKey | HHQIJRZQBXXGDK-QOKANSKSSA-N |
| XLogP | 9.72 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.57 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|