About CID 162227805
CID 162227805 (PubChem CID 162227805) has the molecular formula C40H60B2N4O2
and a molecular weight of 650.57 g/mol.
Molecular Properties
| Compound Name | CID 162227805 |
| PubChem CID | 162227805 |
| Molecular Formula | C40H60B2N4O2 |
| Molecular Weight | 650.57 g/mol |
| Exact Mass | 650.49 |
| IUPAC Name | — |
| SMILES | [B]=NCCCC(C)(CCCN=[B])c1cc(C)c(O)c(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(C(C)(CCCC)CCCC)cc(C)c2O)c1 |
| InChI | InChI=1S/C40H60B2N4O2/c1-7-9-17-39(5,18-10-8-2)33-23-29(3)37(47)31(25-33)27-43-35-15-11-12-16-36(35)44-28-32-26-34(24-30(4)38(32)48)40(6,19-13-21-45-41)20-14-22-46-42/h23-28,35-36,47-48H,7-22H2,1-6H3/b43-27+,44-28+/t35-,36-/m1/s1 |
| InChIKey | HHQIJRZQBXXGDK-QOKANSKSSA-N |
| XLogP | 9.72 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 650.57 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162227805 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162227805?
The IUPAC name of CID 162227805 (CID 162227805) is not available.
What is the SMILES notation for CID 162227805?
The canonical SMILES for CID 162227805 is [B]=NCCCC(C)(CCCN=[B])c1cc(C)c(O)c(/C=N/[C@@H]2CCCC[C@H]2/N=C/c2cc(C(C)(CCCC)CCCC)cc(C)c2O)c1.
What is the InChIKey of CID 162227805?
The InChIKey is HHQIJRZQBXXGDK-QOKANSKSSA-N. The full InChI is InChI=1S/C40H60B2N4O2/c1-7-9-17-39(5,18-10-8-2)33-23-29(3)37(47)31(25-33)27-43-35-15-11-12-16-36(35)44-28-32-26-34(24-30(4)38(32)48)40(6,19-13-21-45-41)20-14-22-46-42/h23-28,35-36,47-48H,7-22H2,1-6H3/b43-27+,44-28+/t35-,36-/m1/s1.
What are the key properties of CID 162227805?
CID 162227805 has a molecular weight of 650.57 g/mol, XLogP of 9.72, 20 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162227805 is sourced from PubChem (CID 162227805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).