About CID 162228626
CID 162228626 (PubChem CID 162228626) has the molecular formula C12H13B2F12O2
and a molecular weight of 440.84 g/mol.
Molecular Properties
| Compound Name | CID 162228626 |
| PubChem CID | 162228626 |
| Molecular Formula | C12H13B2F12O2 |
| Molecular Weight | 440.84 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | — |
| SMILES | C/C=C/C(O)(C(F)(F)F)C(F)(F)F.C=CCC(O)(C(F)(F)F)C(F)(F)F.[3H][B][B] |
| InChI | InChI=1S/2C6H6F6O.B2H/c2*1-2-3-4(13,5(7,8)9)6(10,11)12;1-2/h2-3,13H,1H3;2,13H,1,3H2;1H/b3-2+;;/i;;1T |
| InChIKey | XJPORTUKUHNTKI-HXNKAUPESA-N |
| XLogP | 3.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.84 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 162228626 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162228626?
The IUPAC name of CID 162228626 (CID 162228626) is not available.
What is the SMILES notation for CID 162228626?
The canonical SMILES for CID 162228626 is C/C=C/C(O)(C(F)(F)F)C(F)(F)F.C=CCC(O)(C(F)(F)F)C(F)(F)F.[3H][B][B].
What is the InChIKey of CID 162228626?
The InChIKey is XJPORTUKUHNTKI-HXNKAUPESA-N. The full InChI is InChI=1S/2C6H6F6O.B2H/c2*1-2-3-4(13,5(7,8)9)6(10,11)12;1-2/h2-3,13H,1H3;2,13H,1,3H2;1H/b3-2+;;/i;;1T.
What are the key properties of CID 162228626?
CID 162228626 has a molecular weight of 440.84 g/mol, XLogP of 3.81, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162228626 is sourced from PubChem (CID 162228626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).