C23H20Cl2N2O2 — CID 162228980
[2,4-dichloro-3-[(5-ethynyl-1-methylindol-2-yl)methyl]phenyl]-morpholin-4-ylmethanone (PubChem CID 162228980) has the molecular formula C23H20Cl2N2O2 and a molecular weight of 427.33 g/mol. Its IUPAC name is [2,4-dichloro-3-[(5-ethynyl-1-methylindol-2-yl)methyl]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [2,4-dichloro-3-[(5-ethynyl-1-methylindol-2-yl)methyl]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 162228980 |
| Molecular Formula | C23H20Cl2N2O2 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | [2,4-dichloro-3-[(5-ethynyl-1-methylindol-2-yl)methyl]phenyl]-morpholin-4-ylmethanone |
| SMILES | C#Cc1ccc2c(c1)cc(Cc1c(Cl)ccc(C(=O)N3CCOCC3)c1Cl)n2C |
| InChI | InChI=1S/C23H20Cl2N2O2/c1-3-15-4-7-21-16(12-15)13-17(26(21)2)14-19-20(24)6-5-18(22(19)25)23(28)27-8-10-29-11-9-27/h1,4-7,12-13H,8-11,14H2,2H3 |
| InChIKey | RGJAORAEDOSJAY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|