C21H26ClI2N5 — CID 162231332
2-chloro-4-ethyl-5-iodopyridine;4-ethyl-5-iodopyridin-2-amine;4-ethylpyridin-2-amine (PubChem CID 162231332) has the molecular formula C21H26ClI2N5 and a molecular weight of 637.74 g/mol. Its IUPAC name is 2-chloro-4-ethyl-5-iodopyridine;4-ethyl-5-iodopyridin-2-amine;4-ethylpyridin-2-amine.
| Compound Name | 2-chloro-4-ethyl-5-iodopyridine;4-ethyl-5-iodopyridin-2-amine;4-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 162231332 |
| Molecular Formula | C21H26ClI2N5 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.00 |
| IUPAC Name | 2-chloro-4-ethyl-5-iodopyridine;4-ethyl-5-iodopyridin-2-amine;4-ethylpyridin-2-amine |
| SMILES | CCc1cc(Cl)ncc1I.CCc1cc(N)ncc1I.CCc1ccnc(N)c1 |
| InChI | InChI=1S/C7H7ClIN.C7H9IN2.C7H10N2/c1-2-5-3-7(8)10-4-6(5)9;1-2-5-3-7(9)10-4-6(5)8;1-2-6-3-4-9-7(8)5-6/h3-4H,2H2,1H3;3-4H,2H2,1H3,(H2,9,10);3-5H,2H2,1H3,(H2,8,9) |
| InChIKey | ZVLWTAJOYVWKCK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|