C38H52 — CID 162232111
(4aS,11S,11aR,12S,12aS)-2,4a,5,7,11,11a,12a-heptamethyl-4,6-dimethylidene-12-(2-methylidenebutyl)-10-propan-2-yl-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene (PubChem CID 162232111) has the molecular formula C38H52 and a molecular weight of 508.83 g/mol. Its IUPAC name is (4aS,11S,11aR,12S,12aS)-2,4a,5,7,11,11a,12a-heptamethyl-4,6-dimethylidene-12-(2-methylidenebutyl)-10-propan-2-yl-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene.
| Compound Name | (4aS,11S,11aR,12S,12aS)-2,4a,5,7,11,11a,12a-heptamethyl-4,6-dimethylidene-12-(2-methylidenebutyl)-10-propan-2-yl-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene |
|---|---|
| PubChem CID | 162232111 |
| Molecular Formula | C38H52 |
| Molecular Weight | 508.83 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | (4aS,11S,11aR,12S,12aS)-2,4a,5,7,11,11a,12a-heptamethyl-4,6-dimethylidene-12-(2-methylidenebutyl)-10-propan-2-yl-3-prop-1-en-2-yl-11,12-dihydro-1H-tetracene |
| SMILES | C=C(CC)C[C@@H]1[C@]2(C)C(=C(C)[C@@]3(C)C(=C)C(C(=C)C)=C(C)C[C@@]13C)C(=C)c1c(C)ccc(C(C)C)c1[C@H]2C |
| InChI | InChI=1S/C38H52/c1-16-23(6)19-31-36(13)20-25(8)32(22(4)5)28(11)38(36,15)29(12)35-26(9)33-24(7)17-18-30(21(2)3)34(33)27(10)37(31,35)14/h17-18,21,27,31H,4,6,9,11,16,19-20H2,1-3,5,7-8,10,12-15H3/t27-,31+,36+,37-,38-/m1/s1 |
| InChIKey | ZVOKCYVIUVEYJH-FFXDXGKKSA-N |
| XLogP | 11.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.83 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|