C45H74NaO4P — CID 162232657
sodium 11-oxido-1,3,7,9-tetrakis(2,4,4-trimethylpentan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (PubChem CID 162232657) has the molecular formula C45H74NaO4P and a molecular weight of 733.05 g/mol. Its IUPAC name is sodium 11-oxido-1,3,7,9-tetrakis(2,4,4-trimethylpentan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
| Compound Name | sodium 11-oxido-1,3,7,9-tetrakis(2,4,4-trimethylpentan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
|---|---|
| PubChem CID | 162232657 |
| Molecular Formula | C45H74NaO4P |
| Molecular Weight | 733.05 g/mol |
| Exact Mass | 732.52 |
| IUPAC Name | sodium 11-oxido-1,3,7,9-tetrakis(2,4,4-trimethylpentan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| SMILES | CC(C)(C)CC(C)(C)c1cc2c(c(C(C)(C)CC(C)(C)C)c1)OP(=O)([O-])Oc1c(cc(C(C)(C)CC(C)(C)C)cc1C(C)(C)CC(C)(C)C)C2.[Na+] |
| InChI | InChI=1S/C45H75O4P.Na/c1-38(2,3)26-42(13,14)32-22-30-21-31-23-33(43(15,16)27-39(4,5)6)25-35(45(19,20)29-41(10,11)12)37(31)49-50(46,47)48-36(30)34(24-32)44(17,18)28-40(7,8)9;/h22-25H,21,26-29H2,1-20H3,(H,46,47);/q;+1/p-1 |
| InChIKey | HHJGXKQWGGETSR-UHFFFAOYSA-M |
| XLogP | 10.38 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.05 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|