About phenylhydrazine;1-phenylpyrazol-3-amine
phenylhydrazine;1-phenylpyrazol-3-amine (PubChem CID 162232993) has the molecular formula C15H17N5
and a molecular weight of 267.34 g/mol. Its IUPAC name is phenylhydrazine;1-phenylpyrazol-3-amine.
Molecular Properties
| Compound Name | phenylhydrazine;1-phenylpyrazol-3-amine |
| PubChem CID | 162232993 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | phenylhydrazine;1-phenylpyrazol-3-amine |
| SMILES | NNc1ccccc1.Nc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H9N3.C6H8N2/c10-9-6-7-12(11-9)8-4-2-1-3-5-8;7-8-6-4-2-1-3-5-6/h1-7H,(H2,10,11);1-5,8H,7H2 |
| InChIKey | ZVRKKGGUHLLAFD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenylhydrazine;1-phenylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylhydrazine;1-phenylpyrazol-3-amine?
The IUPAC name of phenylhydrazine;1-phenylpyrazol-3-amine (CID 162232993) is phenylhydrazine;1-phenylpyrazol-3-amine.
What is the SMILES notation for phenylhydrazine;1-phenylpyrazol-3-amine?
The canonical SMILES for phenylhydrazine;1-phenylpyrazol-3-amine is NNc1ccccc1.Nc1ccn(-c2ccccc2)n1.
What is the InChIKey of phenylhydrazine;1-phenylpyrazol-3-amine?
The InChIKey is ZVRKKGGUHLLAFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.C6H8N2/c10-9-6-7-12(11-9)8-4-2-1-3-5-8;7-8-6-4-2-1-3-5-6/h1-7H,(H2,10,11);1-5,8H,7H2.
What are the key properties of phenylhydrazine;1-phenylpyrazol-3-amine?
phenylhydrazine;1-phenylpyrazol-3-amine has a molecular weight of 267.34 g/mol, XLogP of 2.43, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenylhydrazine;1-phenylpyrazol-3-amine is sourced from PubChem (CID 162232993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).