C20H36O10P2S2 — CID 162233383
(2S,3S,4S,5S)-1-[2-[(2S,3S,4S,5S)-3,4-dihydroxy-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane-3,4-diol;methanesulfonic acid (PubChem CID 162233383) has the molecular formula C20H36O10P2S2 and a molecular weight of 562.58 g/mol. Its IUPAC name is (2S,3S,4S,5S)-1-[2-[(2S,3S,4S,5S)-3,4-dihydroxy-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane-3,4-diol;methanesulfonic acid.
| Compound Name | (2S,3S,4S,5S)-1-[2-[(2S,3S,4S,5S)-3,4-dihydroxy-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane-3,4-diol;methanesulfonic acid |
|---|---|
| PubChem CID | 162233383 |
| Molecular Formula | C20H36O10P2S2 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | (2S,3S,4S,5S)-1-[2-[(2S,3S,4S,5S)-3,4-dihydroxy-2,5-dimethylphospholan-1-yl]phenyl]-2,5-dimethylphospholane-3,4-diol;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C[C@H]1[C@@H](O)[C@H](O)[C@H](C)P1c1ccccc1P1[C@@H](C)[C@@H](O)[C@H](O)[C@@H]1C |
| InChI | InChI=1S/C18H28O4P2.2CH4O3S/c1-9-15(19)16(20)10(2)23(9)13-7-5-6-8-14(13)24-11(3)17(21)18(22)12(24)4;2*1-5(2,3)4/h5-12,15-22H,1-4H3;2*1H3,(H,2,3,4)/t9-,10-,11-,12-,15+,16+,17+,18+;;/m0../s1 |
| InChIKey | ZVSVKXJXEZGBDU-DOJUIDEBSA-N |
| XLogP | -0.07 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|