About 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride
5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride (PubChem CID 162233674) has the molecular formula C8H9BrClF3N2O
and a molecular weight of 321.52 g/mol. Its IUPAC name is 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride |
| PubChem CID | 162233674 |
| Molecular Formula | C8H9BrClF3N2O |
| Molecular Weight | 321.52 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride |
| SMILES | CNc1cnc(OCC(F)(F)F)c(Br)c1.Cl |
| InChI | InChI=1S/C8H8BrF3N2O.ClH/c1-13-5-2-6(9)7(14-3-5)15-4-8(10,11)12;/h2-3,13H,4H2,1H3;1H |
| InChIKey | RTFKCAPSBVEWMY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride?
The IUPAC name of 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride (CID 162233674) is 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride.
What is the SMILES notation for 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride?
The canonical SMILES for 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride is CNc1cnc(OCC(F)(F)F)c(Br)c1.Cl.
What is the InChIKey of 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride?
The InChIKey is RTFKCAPSBVEWMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF3N2O.ClH/c1-13-5-2-6(9)7(14-3-5)15-4-8(10,11)12;/h2-3,13H,4H2,1H3;1H.
What are the key properties of 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride?
5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride has a molecular weight of 321.52 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-methyl-6-(2,2,2-trifluoroethoxy)pyridin-3-amine;hydrochloride is sourced from PubChem (CID 162233674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).