C31H39ClF6N8O2S2 — CID 162234173
tert-butyl 4-aminopiperidine-1-carboxylate;4-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine;N-piperidin-4-yl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 162234173) has the molecular formula C31H39ClF6N8O2S2 and a molecular weight of 769.28 g/mol. Its IUPAC name is tert-butyl 4-aminopiperidine-1-carboxylate;4-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine;N-piperidin-4-yl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | tert-butyl 4-aminopiperidine-1-carboxylate;4-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine;N-piperidin-4-yl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 162234173 |
| Molecular Formula | C31H39ClF6N8O2S2 |
| Molecular Weight | 769.28 g/mol |
| Exact Mass | 768.22 |
| IUPAC Name | tert-butyl 4-aminopiperidine-1-carboxylate;4-chloro-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine;N-piperidin-4-yl-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)CC1.FC(F)(F)Cc1cc2c(Cl)ncnc2s1.FC(F)(F)Cc1cc2c(NC3CCNCC3)ncnc2s1 |
| InChI | InChI=1S/C13H15F3N4S.C10H20N2O2.C8H4ClF3N2S/c14-13(15,16)6-9-5-10-11(18-7-19-12(10)21-9)20-8-1-3-17-4-2-8;1-10(2,3)14-9(13)12-6-4-8(11)5-7-12;9-6-5-1-4(2-8(10,11)12)15-7(5)14-3-13-6/h5,7-8,17H,1-4,6H2,(H,18,19,20);8H,4-7,11H2,1-3H3;1,3H,2H2 |
| InChIKey | ZVVMRKZUPXZFFM-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.28 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |