C38H52Br2N2O3Si2 — CID 162234380
CID 162234380 (PubChem CID 162234380) has the molecular formula C38H52Br2N2O3Si2 and a molecular weight of 800.82 g/mol.
| Compound Name | CID 162234380 |
|---|---|
| PubChem CID | 162234380 |
| Molecular Formula | C38H52Br2N2O3Si2 |
| Molecular Weight | 800.82 g/mol |
| Exact Mass | 798.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1c(N)cccc1Br.Cc1cc(C2(C)CC2)ccc1C(=O)Nc1cccc(Br)c1C(C)(C)O[Si]C(C)(C)C |
| InChI | InChI=1S/C25H32BrNO2Si.C13H20BrNOSi/c1-16-15-17(25(7)13-14-25)11-12-18(16)22(28)27-20-10-8-9-19(26)21(20)24(5,6)29-30-23(2,3)4;1-12(2,3)17-16-13(4,5)11-9(14)7-6-8-10(11)15/h8-12,15H,13-14H2,1-7H3,(H,27,28);6-8H,15H2,1-5H3 |
| InChIKey | FGTMTDSXUFHFTN-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.82 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|