C31H22N4O — CID 162234719
2-[3-(1-methyl-2H-imidazo[1,2-a]pyridin-1-ium-2-id-3-yl)phenoxy]-9-phenylpyrido[2,3-b]indole (PubChem CID 162234719) has the molecular formula C31H22N4O and a molecular weight of 466.54 g/mol. Its IUPAC name is 2-[3-(1-methyl-2H-imidazo[1,2-a]pyridin-1-ium-2-id-3-yl)phenoxy]-9-phenylpyrido[2,3-b]indole.
| Compound Name | 2-[3-(1-methyl-2H-imidazo[1,2-a]pyridin-1-ium-2-id-3-yl)phenoxy]-9-phenylpyrido[2,3-b]indole |
|---|---|
| PubChem CID | 162234719 |
| Molecular Formula | C31H22N4O |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-[3-(1-methyl-2H-imidazo[1,2-a]pyridin-1-ium-2-id-3-yl)phenoxy]-9-phenylpyrido[2,3-b]indole |
| SMILES | C[n+]1[c-]c(-c2cccc(Oc3ccc4c5ccccc5n(-c5ccccc5)c4n3)c2)n2ccccc21 |
| InChI | InChI=1S/C31H22N4O/c1-33-21-28(34-19-8-7-16-30(33)34)22-10-9-13-24(20-22)36-29-18-17-26-25-14-5-6-15-27(25)35(31(26)32-29)23-11-3-2-4-12-23/h2-20H,1H3 |
| InChIKey | DWQGXDOBACZBII-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 35.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|