C15H30O5 — CID 162235214
1,3-bis(ethenoxy)-2,2-dimethylpropane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 162235214) has the molecular formula C15H30O5 and a molecular weight of 290.40 g/mol. Its IUPAC name is 1,3-bis(ethenoxy)-2,2-dimethylpropane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 1,3-bis(ethenoxy)-2,2-dimethylpropane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 162235214 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 1,3-bis(ethenoxy)-2,2-dimethylpropane;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | C=COCC(C)(C)COC=C.CCC(CO)(CO)CO |
| InChI | InChI=1S/C9H16O2.C6H14O3/c1-5-10-7-9(3,4)8-11-6-2;1-2-6(3-7,4-8)5-9/h5-6H,1-2,7-8H2,3-4H3;7-9H,2-5H2,1H3 |
| InChIKey | ZVYUCBUFACTTQS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|