C18H18F4N4 — CID 162235773
N-(fluoromethyl)aniline;3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)aniline (PubChem CID 162235773) has the molecular formula C18H18F4N4 and a molecular weight of 366.36 g/mol. Its IUPAC name is N-(fluoromethyl)aniline;3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)aniline.
| Compound Name | N-(fluoromethyl)aniline;3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 162235773 |
| Molecular Formula | C18H18F4N4 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(fluoromethyl)aniline;3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)aniline |
| SMILES | Cc1cn(-c2cc(N)cc(C(F)(F)F)c2)cn1.FCNc1ccccc1 |
| InChI | InChI=1S/C11H10F3N3.C7H8FN/c1-7-5-17(6-16-7)10-3-8(11(12,13)14)2-9(15)4-10;8-6-9-7-4-2-1-3-5-7/h2-6H,15H2,1H3;1-5,9H,6H2 |
| InChIKey | ZWANGBKVPVYBTA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|