About 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea
5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea (PubChem CID 162236937) has the molecular formula C28H26N4O2S2
and a molecular weight of 514.68 g/mol. Its IUPAC name is 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea.
Molecular Properties
| Compound Name | 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea |
| PubChem CID | 162236937 |
| Molecular Formula | C28H26N4O2S2 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea |
| SMILES | COc1cc(-c2ccccc2)c2sc(N)nc2c1.COc1cc(NC(N)=S)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H12N2OS.C14H14N2OS/c1-17-10-7-11(9-5-3-2-4-6-9)13-12(8-10)16-14(15)18-13;1-17-13-8-11(10-5-3-2-4-6-10)7-12(9-13)16-14(15)18/h2-8H,1H3,(H2,15,16);2-9H,1H3,(H3,15,16,18) |
| InChIKey | ZWELDIOMSLFYLC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea?
The IUPAC name of 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea (CID 162236937) is 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea.
What is the SMILES notation for 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea?
The canonical SMILES for 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea is COc1cc(-c2ccccc2)c2sc(N)nc2c1.COc1cc(NC(N)=S)cc(-c2ccccc2)c1.
What is the InChIKey of 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea?
The InChIKey is ZWELDIOMSLFYLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2OS.C14H14N2OS/c1-17-10-7-11(9-5-3-2-4-6-9)13-12(8-10)16-14(15)18-13;1-17-13-8-11(10-5-3-2-4-6-10)7-12(9-13)16-14(15)18/h2-8H,1H3,(H2,15,16);2-9H,1H3,(H3,15,16,18).
What are the key properties of 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea?
5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea has a molecular weight of 514.68 g/mol, XLogP of 6.57, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-7-phenyl-1,3-benzothiazol-2-amine;(3-methoxy-5-phenylphenyl)thiourea is sourced from PubChem (CID 162236937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).