C15H20N4O — CID 162237022
2-[5-(butylamino)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1-cyclopropylethanone (PubChem CID 162237022) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[5-(butylamino)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1-cyclopropylethanone.
| Compound Name | 2-[5-(butylamino)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1-cyclopropylethanone |
|---|---|
| PubChem CID | 162237022 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[5-(butylamino)-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-1-cyclopropylethanone |
| SMILES | CCCCNc1cccc2nc(CC(=O)C3CC3)nn12 |
| InChI | InChI=1S/C15H20N4O/c1-2-3-9-16-14-5-4-6-15-17-13(18-19(14)15)10-12(20)11-7-8-11/h4-6,11,16H,2-3,7-10H2,1H3 |
| InChIKey | ZWESCDDYUBZOPW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|