C21H23Cl2Zr — CID 162237339
2-propan-2-yl-4-(2,3,4-trimethylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride (PubChem CID 162237339) has the molecular formula C21H23Cl2Zr and a molecular weight of 437.55 g/mol. Its IUPAC name is 2-propan-2-yl-4-(2,3,4-trimethylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride.
| Compound Name | 2-propan-2-yl-4-(2,3,4-trimethylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 162237339 |
| Molecular Formula | C21H23Cl2Zr |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 2-propan-2-yl-4-(2,3,4-trimethylphenyl)-1H-inden-1-ide;zirconium(3+);dichloride |
| SMILES | Cc1ccc(-c2cccc3[cH-]c(C(C)C)cc23)c(C)c1C.[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C21H23.2ClH.Zr/c1-13(2)18-11-17-7-6-8-20(21(17)12-18)19-10-9-14(3)15(4)16(19)5;;;/h6-13H,1-5H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | XAZPVKIEYNBGLI-UHFFFAOYSA-L |
| XLogP | 0.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|