C28H43N3O7S2 — CID 162237654
4-(2,3-dimethylindol-3-yl)butane-1-sulfonic acid;5-methyl-6-oxoheptane-1-sulfonic acid;phenylhydrazine (PubChem CID 162237654) has the molecular formula C28H43N3O7S2 and a molecular weight of 597.80 g/mol. Its IUPAC name is 4-(2,3-dimethylindol-3-yl)butane-1-sulfonic acid;5-methyl-6-oxoheptane-1-sulfonic acid;phenylhydrazine.
| Compound Name | 4-(2,3-dimethylindol-3-yl)butane-1-sulfonic acid;5-methyl-6-oxoheptane-1-sulfonic acid;phenylhydrazine |
|---|---|
| PubChem CID | 162237654 |
| Molecular Formula | C28H43N3O7S2 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 4-(2,3-dimethylindol-3-yl)butane-1-sulfonic acid;5-methyl-6-oxoheptane-1-sulfonic acid;phenylhydrazine |
| SMILES | CC(=O)C(C)CCCCS(=O)(=O)O.CC1=Nc2ccccc2C1(C)CCCCS(=O)(=O)O.NNc1ccccc1 |
| InChI | InChI=1S/C14H19NO3S.C8H16O4S.C6H8N2/c1-11-14(2,9-5-6-10-19(16,17)18)12-7-3-4-8-13(12)15-11;1-7(8(2)9)5-3-4-6-13(10,11)12;7-8-6-4-2-1-3-5-6/h3-4,7-8H,5-6,9-10H2,1-2H3,(H,16,17,18);7H,3-6H2,1-2H3,(H,10,11,12);1-5,8H,7H2 |
| InChIKey | ZWGXVVIGVLAJFD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 176.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|