About 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea
1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea (PubChem CID 162238125) has the molecular formula C14H15F3N4O2
and a molecular weight of 328.29 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea.
Molecular Properties
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea |
| PubChem CID | 162238125 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea |
| SMILES | O=C(NCCCn1ccnc1)NC1=CC(C(F)(F)F)=CCC1=O |
| InChI | InChI=1S/C14H15F3N4O2/c15-14(16,17)10-2-3-12(22)11(8-10)20-13(23)19-4-1-6-21-7-5-18-9-21/h2,5,7-9H,1,3-4,6H2,(H2,19,20,23) |
| InChIKey | ZWIJZUIALMVOSG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea?
The IUPAC name of 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea (CID 162238125) is 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea.
What is the SMILES notation for 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea?
The canonical SMILES for 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea is O=C(NCCCn1ccnc1)NC1=CC(C(F)(F)F)=CCC1=O.
What is the InChIKey of 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea?
The InChIKey is ZWIJZUIALMVOSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N4O2/c15-14(16,17)10-2-3-12(22)11(8-10)20-13(23)19-4-1-6-21-7-5-18-9-21/h2,5,7-9H,1,3-4,6H2,(H2,19,20,23).
What are the key properties of 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea?
1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea has a molecular weight of 328.29 g/mol, XLogP of 1.92, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-imidazol-1-ylpropyl)-3-[6-oxo-3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]urea is sourced from PubChem (CID 162238125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).