About zinc;phosphite;trihydrate
zinc;phosphite;trihydrate (PubChem CID 162239335) has the molecular formula H6O6PZn3-3
and a molecular weight of 329.19 g/mol. Its IUPAC name is zinc;phosphite;trihydrate.
Molecular Properties
| Compound Name | zinc;phosphite;trihydrate |
| PubChem CID | 162239335 |
| Molecular Formula | H6O6PZn3-3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 324.78 |
| IUPAC Name | zinc;phosphite;trihydrate |
| SMILES | O.O.O.[O-]P([O-])[O-].[Zn].[Zn].[Zn] |
| InChI | InChI=1S/O3P.3H2O.3Zn/c1-4(2)3;;;;;;/h;3*1H2;;;/q-3;;;;;; |
| InChIKey | ZOUOBGVXBGEQDD-UHFFFAOYSA-N |
| XLogP | -5.19 |
| TPSA | 163.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | -5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc;phosphite;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;phosphite;trihydrate?
The IUPAC name of zinc;phosphite;trihydrate (CID 162239335) is zinc;phosphite;trihydrate.
What is the SMILES notation for zinc;phosphite;trihydrate?
The canonical SMILES for zinc;phosphite;trihydrate is O.O.O.[O-]P([O-])[O-].[Zn].[Zn].[Zn].
What is the InChIKey of zinc;phosphite;trihydrate?
The InChIKey is ZOUOBGVXBGEQDD-UHFFFAOYSA-N. The full InChI is InChI=1S/O3P.3H2O.3Zn/c1-4(2)3;;;;;;/h;3*1H2;;;/q-3;;;;;;.
What are the key properties of zinc;phosphite;trihydrate?
zinc;phosphite;trihydrate has a molecular weight of 329.19 g/mol, XLogP of -5.19, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;phosphite;trihydrate is sourced from PubChem (CID 162239335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).