About N,N-dimethyloctan-1-amine
N,N-dimethyloctan-1-amine (PubChem CID 16224) has the molecular formula C10H23N
and a molecular weight of 157.30 g/mol. Its IUPAC name is N,N-dimethyloctan-1-amine.
Molecular Properties
| Compound Name | N,N-dimethyloctan-1-amine |
| PubChem CID | 16224 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | N,N-dimethyloctan-1-amine |
| SMILES | CCCCCCCCN(C)C |
| InChI | InChI=1S/C10H23N/c1-4-5-6-7-8-9-10-11(2)3/h4-10H2,1-3H3 |
| InChIKey | UQKAOOAFEFCDGT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyloctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyloctan-1-amine?
The IUPAC name of N,N-dimethyloctan-1-amine (CID 16224) is N,N-dimethyloctan-1-amine.
What is the SMILES notation for N,N-dimethyloctan-1-amine?
The canonical SMILES for N,N-dimethyloctan-1-amine is CCCCCCCCN(C)C.
What is the InChIKey of N,N-dimethyloctan-1-amine?
The InChIKey is UQKAOOAFEFCDGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N/c1-4-5-6-7-8-9-10-11(2)3/h4-10H2,1-3H3.
What are the key properties of N,N-dimethyloctan-1-amine?
N,N-dimethyloctan-1-amine has a molecular weight of 157.30 g/mol, XLogP of 2.91, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyloctan-1-amine is sourced from PubChem (CID 16224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).