About acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide
acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide (PubChem CID 162242443) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide.
Molecular Properties
| Compound Name | acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide |
| PubChem CID | 162242443 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide |
| SMILES | CC(N)=O.[H]/N=C1\CCCc2cccc(NC(C)=O)c21 |
| InChI | InChI=1S/C12H14N2O.C2H5NO/c1-8(15)14-11-7-3-5-9-4-2-6-10(13)12(9)11;1-2(3)4/h3,5,7,13H,2,4,6H2,1H3,(H,14,15);1H3,(H2,3,4)/b13-10+; |
| InChIKey | ZWWOCYMCORNLOQ-RSGUCCNWSA-N |
| XLogP | 1.84 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide?
The IUPAC name of acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide (CID 162242443) is acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide.
What is the SMILES notation for acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide?
The canonical SMILES for acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide is CC(N)=O.[H]/N=C1\CCCc2cccc(NC(C)=O)c21.
What is the InChIKey of acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide?
The InChIKey is ZWWOCYMCORNLOQ-RSGUCCNWSA-N. The full InChI is InChI=1S/C12H14N2O.C2H5NO/c1-8(15)14-11-7-3-5-9-4-2-6-10(13)12(9)11;1-2(3)4/h3,5,7,13H,2,4,6H2,1H3,(H,14,15);1H3,(H2,3,4)/b13-10+;.
What are the key properties of acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide?
acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide has a molecular weight of 261.32 g/mol, XLogP of 1.84, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;N-(8-imino-6,7-dihydro-5H-naphthalen-1-yl)acetamide is sourced from PubChem (CID 162242443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).