About boric acid;iron(2+);dinitrate
boric acid;iron(2+);dinitrate (PubChem CID 162242608) has the molecular formula H3BFeN2O9
and a molecular weight of 241.69 g/mol. Its IUPAC name is boric acid;iron(2+);dinitrate.
Molecular Properties
| Compound Name | boric acid;iron(2+);dinitrate |
| PubChem CID | 162242608 |
| Molecular Formula | H3BFeN2O9 |
| Molecular Weight | 241.69 g/mol |
| Exact Mass | 241.93 |
| IUPAC Name | boric acid;iron(2+);dinitrate |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].OB(O)O.[Fe+2] |
| InChI | InChI=1S/BH3O3.Fe.2NO3/c2-1(3)4;;2*2-1(3)4/h2-4H;;;/q;+2;2*-1 |
| InChIKey | ZWXCISVHFLSFRP-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 193.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.69 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze boric acid;iron(2+);dinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;iron(2+);dinitrate?
The IUPAC name of boric acid;iron(2+);dinitrate (CID 162242608) is boric acid;iron(2+);dinitrate.
What is the SMILES notation for boric acid;iron(2+);dinitrate?
The canonical SMILES for boric acid;iron(2+);dinitrate is O=[N+]([O-])[O-].O=[N+]([O-])[O-].OB(O)O.[Fe+2].
What is the InChIKey of boric acid;iron(2+);dinitrate?
The InChIKey is ZWXCISVHFLSFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/BH3O3.Fe.2NO3/c2-1(3)4;;2*2-1(3)4/h2-4H;;;/q;+2;2*-1.
What are the key properties of boric acid;iron(2+);dinitrate?
boric acid;iron(2+);dinitrate has a molecular weight of 241.69 g/mol, XLogP of -2.53, 0 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;iron(2+);dinitrate is sourced from PubChem (CID 162242608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).