C46H63NO2P2 — CID 162243387
(2R,5R)-N-butyl-N-[(3-tert-butyl-4-methoxyphenyl)-(3,5-ditert-butyl-4-methoxyphenyl)phosphanyl]-2,5-diphenylphospholan-1-amine (PubChem CID 162243387) has the molecular formula C46H63NO2P2 and a molecular weight of 723.96 g/mol. Its IUPAC name is (2R,5R)-N-butyl-N-[(3-tert-butyl-4-methoxyphenyl)-(3,5-ditert-butyl-4-methoxyphenyl)phosphanyl]-2,5-diphenylphospholan-1-amine.
| Compound Name | (2R,5R)-N-butyl-N-[(3-tert-butyl-4-methoxyphenyl)-(3,5-ditert-butyl-4-methoxyphenyl)phosphanyl]-2,5-diphenylphospholan-1-amine |
|---|---|
| PubChem CID | 162243387 |
| Molecular Formula | C46H63NO2P2 |
| Molecular Weight | 723.96 g/mol |
| Exact Mass | 723.43 |
| IUPAC Name | (2R,5R)-N-butyl-N-[(3-tert-butyl-4-methoxyphenyl)-(3,5-ditert-butyl-4-methoxyphenyl)phosphanyl]-2,5-diphenylphospholan-1-amine |
| SMILES | CCCCN(P(c1ccc(OC)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1)P1[C@@H](c2ccccc2)CC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C46H63NO2P2/c1-13-14-29-47(51-41(33-21-17-15-18-22-33)27-28-42(51)34-23-19-16-20-24-34)50(35-25-26-40(48-11)37(30-35)44(2,3)4)36-31-38(45(5,6)7)43(49-12)39(32-36)46(8,9)10/h15-26,30-32,41-42H,13-14,27-29H2,1-12H3/t41-,42-,50?/m1/s1 |
| InChIKey | HPQWRVWIPKWSAF-RUWWBTJKSA-N |
| XLogP | 12.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.96 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|