About methanol;methoxymethanediol
methanol;methoxymethanediol (PubChem CID 162244729) has the molecular formula C3H10O4
and a molecular weight of 110.11 g/mol. Its IUPAC name is methanol;methoxymethanediol.
Molecular Properties
| Compound Name | methanol;methoxymethanediol |
| PubChem CID | 162244729 |
| Molecular Formula | C3H10O4 |
| Molecular Weight | 110.11 g/mol |
| Exact Mass | 110.06 |
| IUPAC Name | methanol;methoxymethanediol |
| SMILES | CO.COC(O)O |
| InChI | InChI=1S/C2H6O3.CH4O/c1-5-2(3)4;1-2/h2-4H,1H3;2H,1H3 |
| InChIKey | ZXEHLAXOTPOMAA-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.11 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methanol;methoxymethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;methoxymethanediol?
The IUPAC name of methanol;methoxymethanediol (CID 162244729) is methanol;methoxymethanediol.
What is the SMILES notation for methanol;methoxymethanediol?
The canonical SMILES for methanol;methoxymethanediol is CO.COC(O)O.
What is the InChIKey of methanol;methoxymethanediol?
The InChIKey is ZXEHLAXOTPOMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O3.CH4O/c1-5-2(3)4;1-2/h2-4H,1H3;2H,1H3.
What are the key properties of methanol;methoxymethanediol?
methanol;methoxymethanediol has a molecular weight of 110.11 g/mol, XLogP of -1.49, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;methoxymethanediol is sourced from PubChem (CID 162244729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).