C21H35F4NO9 — CID 162245728
3-[4-[2-[[2-[1,1-difluoro-2-(2-hydroxy-4-prop-2-enoxybutoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-hydroxybutoxy]propanenitrile (PubChem CID 162245728) has the molecular formula C21H35F4NO9 and a molecular weight of 521.50 g/mol. Its IUPAC name is 3-[4-[2-[[2-[1,1-difluoro-2-(2-hydroxy-4-prop-2-enoxybutoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-hydroxybutoxy]propanenitrile.
| Compound Name | 3-[4-[2-[[2-[1,1-difluoro-2-(2-hydroxy-4-prop-2-enoxybutoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-hydroxybutoxy]propanenitrile |
|---|---|
| PubChem CID | 162245728 |
| Molecular Formula | C21H35F4NO9 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 3-[4-[2-[[2-[1,1-difluoro-2-(2-hydroxy-4-prop-2-enoxybutoxy)ethoxy]-2,2-difluoroethoxy]methoxy]ethoxy]-3-hydroxybutoxy]propanenitrile |
| SMILES | C=CCOCCC(O)COCC(F)(F)OC(F)(F)COCOCCOCC(O)CCOCCC#N |
| InChI | InChI=1S/C21H35F4NO9/c1-2-7-29-9-4-19(28)14-33-15-20(22,23)35-21(24,25)16-34-17-32-12-11-31-13-18(27)5-10-30-8-3-6-26/h2,18-19,27-28H,1,3-5,7-17H2 |
| InChIKey | ZXHPEAVOCZJTBR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|