C27H54N4O7Si2 — CID 162246548
N'-(1-phenylprop-2-enyl)-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine;3-triethoxysilylpropylurea (PubChem CID 162246548) has the molecular formula C27H54N4O7Si2 and a molecular weight of 602.92 g/mol. Its IUPAC name is N'-(1-phenylprop-2-enyl)-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine;3-triethoxysilylpropylurea.
| Compound Name | N'-(1-phenylprop-2-enyl)-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine;3-triethoxysilylpropylurea |
|---|---|
| PubChem CID | 162246548 |
| Molecular Formula | C27H54N4O7Si2 |
| Molecular Weight | 602.92 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | N'-(1-phenylprop-2-enyl)-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine;3-triethoxysilylpropylurea |
| SMILES | C=CC(NCCNCCC[Si](OC)(OC)OC)c1ccccc1.CCO[Si](CCCNC(N)=O)(OCC)OCC |
| InChI | InChI=1S/C17H30N2O3Si.C10H24N2O4Si/c1-5-17(16-10-7-6-8-11-16)19-14-13-18-12-9-15-23(20-2,21-3)22-4;1-4-14-17(15-5-2,16-6-3)9-7-8-12-10(11)13/h5-8,10-11,17-19H,1,9,12-15H2,2-4H3;4-9H2,1-3H3,(H3,11,12,13) |
| InChIKey | ZXKIPYORXUSRFD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.92 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|