About 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane
2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane (PubChem CID 162247264) has the molecular formula C6H2ClF7S
and a molecular weight of 274.59 g/mol. Its IUPAC name is 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane.
Molecular Properties
| Compound Name | 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane |
| PubChem CID | 162247264 |
| Molecular Formula | C6H2ClF7S |
| Molecular Weight | 274.59 g/mol |
| Exact Mass | 273.95 |
| IUPAC Name | 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane |
| SMILES | FS(F)(F)F.Fc1cc(F)c(Cl)c(F)c1 |
| InChI | InChI=1S/C6H2ClF3.F4S/c7-6-4(9)1-3(8)2-5(6)10;1-5(2,3)4/h1-2H; |
| InChIKey | ZXMULKKSEPZCDO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane?
The IUPAC name of 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane (CID 162247264) is 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane.
What is the SMILES notation for 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane?
The canonical SMILES for 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane is FS(F)(F)F.Fc1cc(F)c(Cl)c(F)c1.
What is the InChIKey of 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane?
The InChIKey is ZXMULKKSEPZCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2ClF3.F4S/c7-6-4(9)1-3(8)2-5(6)10;1-5(2,3)4/h1-2H;.
What are the key properties of 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane?
2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane has a molecular weight of 274.59 g/mol, XLogP of 5.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3,5-trifluorobenzene;tetrafluoro-λ4-sulfane is sourced from PubChem (CID 162247264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).