C22H38O4Si — CID 162248534
2-[(3R)-3-hydroxy-3-methyl-6-(3-trimethylsilylpropoxy)hexyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 162248534) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is 2-[(3R)-3-hydroxy-3-methyl-6-(3-trimethylsilylpropoxy)hexyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(3R)-3-hydroxy-3-methyl-6-(3-trimethylsilylpropoxy)hexyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 162248534 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2-[(3R)-3-hydroxy-3-methyl-6-(3-trimethylsilylpropoxy)hexyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CC[C@@](C)(O)CCCOCCC[Si](C)(C)C)=C(C)C1=O |
| InChI | InChI=1S/C22H38O4Si/c1-16-17(2)21(24)19(18(3)20(16)23)10-12-22(4,25)11-8-13-26-14-9-15-27(5,6)7/h25H,8-15H2,1-7H3/t22-/m0/s1 |
| InChIKey | ZXRAVGDVISDHSB-QFIPXVFZSA-N |
| XLogP | 4.85 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|