C8H4O6Y — CID 162249156
4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone;yttrium (PubChem CID 162249156) has the molecular formula C8H4O6Y and a molecular weight of 285.02 g/mol. Its IUPAC name is 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone;yttrium.
| Compound Name | 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone;yttrium |
|---|---|
| PubChem CID | 162249156 |
| Molecular Formula | C8H4O6Y |
| Molecular Weight | 285.02 g/mol |
| Exact Mass | 284.91 |
| IUPAC Name | 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone;yttrium |
| SMILES | O=C1OC(=O)C2C1C1C(=O)OC(=O)C21.[Y] |
| InChI | InChI=1S/C8H4O6.Y/c9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12;/h1-4H; |
| InChIKey | ZXTCLQXNFVTYAJ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.02 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|