C14H15ClN4O4S2 — CID 162251495
azane;2-[2-[[[3-(1-chlorocyclopropyl)-3-oxopropanoyl]amino]methyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 162251495) has the molecular formula C14H15ClN4O4S2 and a molecular weight of 402.89 g/mol. Its IUPAC name is azane;2-[2-[[[3-(1-chlorocyclopropyl)-3-oxopropanoyl]amino]methyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | azane;2-[2-[[[3-(1-chlorocyclopropyl)-3-oxopropanoyl]amino]methyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 162251495 |
| Molecular Formula | C14H15ClN4O4S2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | azane;2-[2-[[[3-(1-chlorocyclopropyl)-3-oxopropanoyl]amino]methyl]-1,3-thiazol-4-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | N.O=C(CC(=O)C1(Cl)CC1)NCc1nc(-c2nc(C(=O)O)cs2)cs1 |
| InChI | InChI=1S/C14H12ClN3O4S2.H3N/c15-14(1-2-14)9(19)3-10(20)16-4-11-17-7(5-23-11)12-18-8(6-24-12)13(21)22;/h5-6H,1-4H2,(H,16,20)(H,21,22);1H3 |
| InChIKey | QROKJTJAZLIKOI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 144.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|