C21H18F3N3O2 — CID 162251699
1-(2-methylidene-1,3-dihydroindol-5-yl)-3-[[2-(trifluoromethyl)phenyl]diazenyl]pentane-2,4-dione (PubChem CID 162251699) has the molecular formula C21H18F3N3O2 and a molecular weight of 401.39 g/mol. Its IUPAC name is 1-(2-methylidene-1,3-dihydroindol-5-yl)-3-[[2-(trifluoromethyl)phenyl]diazenyl]pentane-2,4-dione.
| Compound Name | 1-(2-methylidene-1,3-dihydroindol-5-yl)-3-[[2-(trifluoromethyl)phenyl]diazenyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 162251699 |
| Molecular Formula | C21H18F3N3O2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-(2-methylidene-1,3-dihydroindol-5-yl)-3-[[2-(trifluoromethyl)phenyl]diazenyl]pentane-2,4-dione |
| SMILES | C=C1Cc2cc(CC(=O)C(/N=N/c3ccccc3C(F)(F)F)C(C)=O)ccc2N1 |
| InChI | InChI=1S/C21H18F3N3O2/c1-12-9-15-10-14(7-8-17(15)25-12)11-19(29)20(13(2)28)27-26-18-6-4-3-5-16(18)21(22,23)24/h3-8,10,20,25H,1,9,11H2,2H3/b27-26+ |
| InChIKey | VMFAOJAUMRGELA-CYYJNZCTSA-N |
| XLogP | 5.04 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|