C24H28F3N3OS — CID 162251850
4-(2-methoxypyrimidin-5-yl)-2-[[4-octyl-3-(trifluoromethyl)phenyl]methyl]-1,3-thiazole (PubChem CID 162251850) has the molecular formula C24H28F3N3OS and a molecular weight of 463.57 g/mol. Its IUPAC name is 4-(2-methoxypyrimidin-5-yl)-2-[[4-octyl-3-(trifluoromethyl)phenyl]methyl]-1,3-thiazole.
| Compound Name | 4-(2-methoxypyrimidin-5-yl)-2-[[4-octyl-3-(trifluoromethyl)phenyl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 162251850 |
| Molecular Formula | C24H28F3N3OS |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-(2-methoxypyrimidin-5-yl)-2-[[4-octyl-3-(trifluoromethyl)phenyl]methyl]-1,3-thiazole |
| SMILES | CCCCCCCCc1ccc(Cc2nc(-c3cnc(OC)nc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H28F3N3OS/c1-3-4-5-6-7-8-9-18-11-10-17(12-20(18)24(25,26)27)13-22-30-21(16-32-22)19-14-28-23(31-2)29-15-19/h10-12,14-16H,3-9,13H2,1-2H3 |
| InChIKey | ZYCBPQRIYDJVLV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|