C22H41N5O2 — CID 162252058
2-[3-[(3R)-6,6-diethyl-2-methylidene-5,8-dioxo-1,7-diazacyclopentadec-3-yl]propyl]guanidine (PubChem CID 162252058) has the molecular formula C22H41N5O2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 2-[3-[(3R)-6,6-diethyl-2-methylidene-5,8-dioxo-1,7-diazacyclopentadec-3-yl]propyl]guanidine.
| Compound Name | 2-[3-[(3R)-6,6-diethyl-2-methylidene-5,8-dioxo-1,7-diazacyclopentadec-3-yl]propyl]guanidine |
|---|---|
| PubChem CID | 162252058 |
| Molecular Formula | C22H41N5O2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.33 |
| IUPAC Name | 2-[3-[(3R)-6,6-diethyl-2-methylidene-5,8-dioxo-1,7-diazacyclopentadec-3-yl]propyl]guanidine |
| SMILES | C=C1NCCCCCCCC(=O)NC(CC)(CC)C(=O)C[C@H]1CCCN=C(N)N |
| InChI | InChI=1S/C22H41N5O2/c1-4-22(5-2)19(28)16-18(12-11-15-26-21(23)24)17(3)25-14-10-8-6-7-9-13-20(29)27-22/h18,25H,3-16H2,1-2H3,(H,27,29)(H4,23,24,26)/t18-/m1/s1 |
| InChIKey | DWIPCYZKWFYNFI-GOSISDBHSA-N |
| XLogP | 2.75 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|