C28H34N2O3 — CID 162253115
[3-[2-(2,6-diethyl-3-pyridinyl)-1-methylindol-6-yl]oxy-2,2-dimethylcyclopentyl] prop-2-enoate (PubChem CID 162253115) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is [3-[2-(2,6-diethyl-3-pyridinyl)-1-methylindol-6-yl]oxy-2,2-dimethylcyclopentyl] prop-2-enoate.
| Compound Name | [3-[2-(2,6-diethyl-3-pyridinyl)-1-methylindol-6-yl]oxy-2,2-dimethylcyclopentyl] prop-2-enoate |
|---|---|
| PubChem CID | 162253115 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | [3-[2-(2,6-diethyl-3-pyridinyl)-1-methylindol-6-yl]oxy-2,2-dimethylcyclopentyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1CCC(Oc2ccc3cc(-c4ccc(CC)nc4CC)n(C)c3c2)C1(C)C |
| InChI | InChI=1S/C28H34N2O3/c1-7-19-11-13-21(22(8-2)29-19)24-16-18-10-12-20(17-23(18)30(24)6)32-25-14-15-26(28(25,4)5)33-27(31)9-3/h9-13,16-17,25-26H,3,7-8,14-15H2,1-2,4-6H3 |
| InChIKey | KFZRYZVWARTVHZ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|