About 2,4-dimethyl-1,3-dioxolane;methane
2,4-dimethyl-1,3-dioxolane;methane (PubChem CID 162253939) has the molecular formula C6H14O2
and a molecular weight of 118.18 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-dioxolane;methane.
Molecular Properties
| Compound Name | 2,4-dimethyl-1,3-dioxolane;methane |
| PubChem CID | 162253939 |
| Molecular Formula | C6H14O2 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.10 |
| IUPAC Name | 2,4-dimethyl-1,3-dioxolane;methane |
| SMILES | C.CC1COC(C)O1 |
| InChI | InChI=1S/C5H10O2.CH4/c1-4-3-6-5(2)7-4;/h4-5H,3H2,1-2H3;1H4 |
| InChIKey | ZYIUFVNVHROKMU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethyl-1,3-dioxolane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1,3-dioxolane;methane?
The IUPAC name of 2,4-dimethyl-1,3-dioxolane;methane (CID 162253939) is 2,4-dimethyl-1,3-dioxolane;methane.
What is the SMILES notation for 2,4-dimethyl-1,3-dioxolane;methane?
The canonical SMILES for 2,4-dimethyl-1,3-dioxolane;methane is C.CC1COC(C)O1.
What is the InChIKey of 2,4-dimethyl-1,3-dioxolane;methane?
The InChIKey is ZYIUFVNVHROKMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.CH4/c1-4-3-6-5(2)7-4;/h4-5H,3H2,1-2H3;1H4.
What are the key properties of 2,4-dimethyl-1,3-dioxolane;methane?
2,4-dimethyl-1,3-dioxolane;methane has a molecular weight of 118.18 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1,3-dioxolane;methane is sourced from PubChem (CID 162253939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).