C29H33N3O9 — CID 162254934
N-[4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]phenyl]quinolin-2-amine;oxalic acid (PubChem CID 162254934) has the molecular formula C29H33N3O9 and a molecular weight of 567.60 g/mol. Its IUPAC name is N-[4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]phenyl]quinolin-2-amine;oxalic acid.
| Compound Name | N-[4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]phenyl]quinolin-2-amine;oxalic acid |
|---|---|
| PubChem CID | 162254934 |
| Molecular Formula | C29H33N3O9 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | N-[4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]phenyl]quinolin-2-amine;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(O)C(=O)O.c1ccc2nc(Nc3ccc(OCCCN4CC5CCCC5C4)cc3)ccc2c1 |
| InChI | InChI=1S/C25H29N3O.2C2H2O4/c1-2-8-24-19(5-1)9-14-25(27-24)26-22-10-12-23(13-11-22)29-16-4-15-28-17-20-6-3-7-21(20)18-28;2*3-1(4)2(5)6/h1-2,5,8-14,20-21H,3-4,6-7,15-18H2,(H,26,27);2*(H,3,4)(H,5,6) |
| InChIKey | ZYLWIEJTGILMCR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 186.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|