C20H22N4O4 — CID 162255854
5-amino-1-ethyl-3H-indol-2-one;1-ethyl-5-nitro-3H-indol-2-one (PubChem CID 162255854) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-amino-1-ethyl-3H-indol-2-one;1-ethyl-5-nitro-3H-indol-2-one.
| Compound Name | 5-amino-1-ethyl-3H-indol-2-one;1-ethyl-5-nitro-3H-indol-2-one |
|---|---|
| PubChem CID | 162255854 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5-amino-1-ethyl-3H-indol-2-one;1-ethyl-5-nitro-3H-indol-2-one |
| SMILES | CCN1C(=O)Cc2cc(N)ccc21.CCN1C(=O)Cc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C10H10N2O3.C10H12N2O/c1-2-11-9-4-3-8(12(14)15)5-7(9)6-10(11)13;1-2-12-9-4-3-8(11)5-7(9)6-10(12)13/h3-5H,2,6H2,1H3;3-5H,2,6,11H2,1H3 |
| InChIKey | ZYOVEQJAVVFHAZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|