About CID 162256127
CID 162256127 (PubChem CID 162256127) has the molecular formula C28H50BaN6
and a molecular weight of 608.08 g/mol.
Molecular Properties
| Compound Name | CID 162256127 |
| PubChem CID | 162256127 |
| Molecular Formula | C28H50BaN6 |
| Molecular Weight | 608.08 g/mol |
| Exact Mass | 608.31 |
| IUPAC Name | — |
| SMILES | CC1=C(C)/C(=N\C(C)(C)C)N/C1=N/C(C)(C)C.CC1=C(C)/C(=N\C(C)(C)C)N/C1=N/C(C)(C)C.[Ba] |
| InChI | InChI=1S/2C14H25N3.Ba/c2*1-9-10(2)12(17-14(6,7)8)15-11(9)16-13(3,4)5;/h2*1-8H3,(H,15,16,17); |
| InChIKey | ZYPSUYFWGYPCBW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.08 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 162256127 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162256127?
The IUPAC name of CID 162256127 (CID 162256127) is not available.
What is the SMILES notation for CID 162256127?
The canonical SMILES for CID 162256127 is CC1=C(C)/C(=N\C(C)(C)C)N/C1=N/C(C)(C)C.CC1=C(C)/C(=N\C(C)(C)C)N/C1=N/C(C)(C)C.[Ba].
What is the InChIKey of CID 162256127?
The InChIKey is ZYPSUYFWGYPCBW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H25N3.Ba/c2*1-9-10(2)12(17-14(6,7)8)15-11(9)16-13(3,4)5;/h2*1-8H3,(H,15,16,17);.
What are the key properties of CID 162256127?
CID 162256127 has a molecular weight of 608.08 g/mol, XLogP of 6.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162256127 is sourced from PubChem (CID 162256127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).