C34H27BrN6O2 — CID 162256128
4-bromobenzamide;5-isocyano-6-methyl-1H-indole;4-(5-isocyano-6-methylindol-1-yl)benzamide (PubChem CID 162256128) has the molecular formula C34H27BrN6O2 and a molecular weight of 631.53 g/mol. Its IUPAC name is 4-bromobenzamide;5-isocyano-6-methyl-1H-indole;4-(5-isocyano-6-methylindol-1-yl)benzamide.
| Compound Name | 4-bromobenzamide;5-isocyano-6-methyl-1H-indole;4-(5-isocyano-6-methylindol-1-yl)benzamide |
|---|---|
| PubChem CID | 162256128 |
| Molecular Formula | C34H27BrN6O2 |
| Molecular Weight | 631.53 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | 4-bromobenzamide;5-isocyano-6-methyl-1H-indole;4-(5-isocyano-6-methylindol-1-yl)benzamide |
| SMILES | NC(=O)c1ccc(Br)cc1.[C-]#[N+]c1cc2cc[nH]c2cc1C.[C-]#[N+]c1cc2ccn(-c3ccc(C(N)=O)cc3)c2cc1C |
| InChI | InChI=1S/C17H13N3O.C10H8N2.C7H6BrNO/c1-11-9-16-13(10-15(11)19-2)7-8-20(16)14-5-3-12(4-6-14)17(18)21;1-7-5-10-8(3-4-12-10)6-9(7)11-2;8-6-3-1-5(2-4-6)7(9)10/h3-10H,1H3,(H2,18,21);3-6,12H,1H3;1-4H,(H2,9,10) |
| InChIKey | ZYPSVFCLHGXCCX-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.53 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|