C19H27F3N6O2S — CID 162256555
(2S)-1,5-dimethyl-2-propan-2-yl-7-[[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrazol-4-yl]methylamino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one;sulfane (PubChem CID 162256555) has the molecular formula C19H27F3N6O2S and a molecular weight of 460.53 g/mol. Its IUPAC name is (2S)-1,5-dimethyl-2-propan-2-yl-7-[[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrazol-4-yl]methylamino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one;sulfane.
| Compound Name | (2S)-1,5-dimethyl-2-propan-2-yl-7-[[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrazol-4-yl]methylamino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one;sulfane |
|---|---|
| PubChem CID | 162256555 |
| Molecular Formula | C19H27F3N6O2S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (2S)-1,5-dimethyl-2-propan-2-yl-7-[[1-(3,3,3-trifluoro-2-hydroxypropyl)pyrazol-4-yl]methylamino]-2,4-dihydropyrido[3,4-b]pyrazin-3-one;sulfane |
| SMILES | Cc1nc(NCc2cnn(CC(O)C(F)(F)F)c2)cc2c1NC(=O)[C@H](C(C)C)N2C.S |
| InChI | InChI=1S/C19H25F3N6O2.H2S/c1-10(2)17-18(30)26-16-11(3)25-15(5-13(16)27(17)4)23-6-12-7-24-28(8-12)9-14(29)19(20,21)22;/h5,7-8,10,14,17,29H,6,9H2,1-4H3,(H,23,25)(H,26,30);1H2/t14?,17-;/m0./s1 |
| InChIKey | ZYRAPAVAQHMKBP-UXRSAYELSA-N |
| XLogP | 2.65 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |