C26H35ClN6O5 — CID 162257025
1-[2-[3-(3-amino-6-chloropyrazin-2-yl)-3-oxopropyl]-1,3-diethylbenzimidazol-1-ium-5-yl]oxy-5-(dimethylamino)pentan-2-one formate (PubChem CID 162257025) has the molecular formula C26H35ClN6O5 and a molecular weight of 547.06 g/mol. Its IUPAC name is 1-[2-[3-(3-amino-6-chloropyrazin-2-yl)-3-oxopropyl]-1,3-diethylbenzimidazol-1-ium-5-yl]oxy-5-(dimethylamino)pentan-2-one formate.
| Compound Name | 1-[2-[3-(3-amino-6-chloropyrazin-2-yl)-3-oxopropyl]-1,3-diethylbenzimidazol-1-ium-5-yl]oxy-5-(dimethylamino)pentan-2-one formate |
|---|---|
| PubChem CID | 162257025 |
| Molecular Formula | C26H35ClN6O5 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 1-[2-[3-(3-amino-6-chloropyrazin-2-yl)-3-oxopropyl]-1,3-diethylbenzimidazol-1-ium-5-yl]oxy-5-(dimethylamino)pentan-2-one formate |
| SMILES | CCn1c(CCC(=O)c2nc(Cl)cnc2N)[n+](CC)c2ccc(OCC(=O)CCCN(C)C)cc21.O=C[O-] |
| InChI | InChI=1S/C25H33ClN6O3.CH2O2/c1-5-31-19-10-9-18(35-16-17(33)8-7-13-30(3)4)14-20(19)32(6-2)23(31)12-11-21(34)24-25(27)28-15-22(26)29-24;2-1-3/h9-10,14-15H,5-8,11-13,16H2,1-4H3,(H-,27,28,34);1H,(H,2,3) |
| InChIKey | ZYSPNBANLOKRNX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|