C24H25ClN6S — CID 162257227
4-N-[4-benzyl-6-[(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methyl]pyrimidin-2-yl]cyclohexane-1,4-diamine (PubChem CID 162257227) has the molecular formula C24H25ClN6S and a molecular weight of 465.03 g/mol. Its IUPAC name is 4-N-[4-benzyl-6-[(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methyl]pyrimidin-2-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[4-benzyl-6-[(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methyl]pyrimidin-2-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 162257227 |
| Molecular Formula | C24H25ClN6S |
| Molecular Weight | 465.03 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 4-N-[4-benzyl-6-[(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)methyl]pyrimidin-2-yl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2nc(Cc3ccccc3)cc(Cc3nc4ccc(Cl)nc4s3)n2)CC1 |
| InChI | InChI=1S/C24H25ClN6S/c25-21-11-10-20-23(31-21)32-22(30-20)14-19-13-18(12-15-4-2-1-3-5-15)28-24(29-19)27-17-8-6-16(26)7-9-17/h1-5,10-11,13,16-17H,6-9,12,14,26H2,(H,27,28,29) |
| InChIKey | ZYTGZYQVHVXKEW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.03 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|