C40H34IN7O4 — CID 162257640
ethyl 5-(4-cyanophenyl)-1-[4-(dimethylamino)phenyl]pyrazole-3-carboxylate;ethyl 5-(4-cyanophenyl)-1-(4-iodophenyl)pyrazole-3-carboxylate (PubChem CID 162257640) has the molecular formula C40H34IN7O4 and a molecular weight of 803.66 g/mol. Its IUPAC name is ethyl 5-(4-cyanophenyl)-1-[4-(dimethylamino)phenyl]pyrazole-3-carboxylate;ethyl 5-(4-cyanophenyl)-1-(4-iodophenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 5-(4-cyanophenyl)-1-[4-(dimethylamino)phenyl]pyrazole-3-carboxylate;ethyl 5-(4-cyanophenyl)-1-(4-iodophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 162257640 |
| Molecular Formula | C40H34IN7O4 |
| Molecular Weight | 803.66 g/mol |
| Exact Mass | 803.17 |
| IUPAC Name | ethyl 5-(4-cyanophenyl)-1-[4-(dimethylamino)phenyl]pyrazole-3-carboxylate;ethyl 5-(4-cyanophenyl)-1-(4-iodophenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(C#N)cc2)n(-c2ccc(I)cc2)n1.CCOC(=O)c1cc(-c2ccc(C#N)cc2)n(-c2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C21H20N4O2.C19H14IN3O2/c1-4-27-21(26)19-13-20(16-7-5-15(14-22)6-8-16)25(23-19)18-11-9-17(10-12-18)24(2)3;1-2-25-19(24)17-11-18(14-5-3-13(12-21)4-6-14)23(22-17)16-9-7-15(20)8-10-16/h5-13H,4H2,1-3H3;3-11H,2H2,1H3 |
| InChIKey | ZYUPYQAOTUKCCW-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 139.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.66 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|